On Target TRPV3_HUMAN 0.22666667/CHEMBL3692338
For the given ligand NB001, we have found in our database that, being scored 0.22666667, the most similar ligand is CHEMBL3692338. Check out the elaboration below.
| NB001 (Given Ligand) | CHEMBL3692338 (Similar Ligand) |
|---|---|
| Nc1ncnc2c1ncn2CCNCCCCCO | CC(C)[C@H](CO)NCc1nc(ncc1F)c2ccc(cc2)C(F)(F)F |
|
|
|
|
|
|
| 0000000a 01801c00 00180000 48080620 00180040 0000c000 00008000 20000800 00600100 00000080 0020900c 40011000 00001002 01800000 00080880 100c000c 00000000 00000000 00400000 80200201 80000000 30000040 21800041 02100014 08000000 00000000 00000000 10000000 08000008 00460010 c0080000 00000ac0 | 0000009a 00000800 00100100 14050e00 000000a0 00184002 00401400 08083041 00000100 10000850 00218004 40008800 00000002 01109000 00020400 000c000c 12000208 12006022 80400000 00400201 00000000 18018000 23800040 20400110 00004000 c0000400 00000100 90001000 00000104 00660400 60108800 200002a0 |