On Target CHLE_HUMAN 0.33870968/CHEMBL40302
For the given ligand NB001, we have found in our database that, being scored 0.33870968, the most similar ligand is CHEMBL40302. Check out the elaboration below.
| NB001 (Given Ligand) | CHEMBL40302 (Similar Ligand) |
|---|---|
| Nc1ncnc2c1ncn2CCNCCCCCO | Cc1cccc2COP(=O)(OCC3CCC(O3)n4cnc5c(N)ncnc45)Oc12 |
|
|
|
|
|
|
| 0000000a 01801c00 00180000 48080620 00180040 0000c000 00008000 20000800 00600100 00000080 0020900c 40011000 00001002 01800000 00080880 100c000c 00000000 00000000 00400000 80200201 80000000 30000040 21800041 02100014 08000000 00000000 00000000 10000000 08000008 00460010 c0080000 00000ac0 | 0020000a 01c01808 22080112 89098628 00180055 0008c000 1202cc00 00000800 08404100 410008f0 0c00800c 40419004 00001002 038a0128 00081080 101eaa8c 002a0020 02880000 38400000 c0a25843 80080020 1c000870 25800040 0a402014 10000422 c0000002 0e000200 10030060 02000208 00460004 d4680000 201380c0 |