On Target BACE1_HUMAN 0.32089552/CHEMBL2047227
For the given ligand NB001, we have found in our database that, being scored 0.32089552, the most similar ligand is CHEMBL2047227. Check out the elaboration below.
| NB001 (Given Ligand) | CHEMBL2047227 (Similar Ligand) |
|---|---|
| Nc1ncnc2c1ncn2CCNCCCCCO | Fc1ccc(CNc2ccnc(NC3CCN(Cc4ccccc4)CC3)n2)cc1 |
|
|
|
|
|
|
| 0000000a 01801c00 00180000 48080620 00180040 0000c000 00008000 20000800 00600100 00000080 0020900c 40011000 00001002 01800000 00080880 100c000c 00000000 00000000 00400000 80200201 80000000 30000040 21800041 02100014 08000000 00000000 00000000 10000000 08000008 00460010 c0080000 00000ac0 | 00010002 01000401 00100100 0a090600 02000008 00004010 0000a000 22101880 00000100 200009e0 00200004 5001d000 04000802 00001000 00000400 000c0004 00040000 02004100 00400000 00b00201 00100000 1c048000 20814840 00500010 00000000 c0000080 00000000 900000c1 00000118 00468810 60041000 000002c0 |