On Target HPGDS_HUMAN 0.42592594/CHEMBL3134492
For the given ligand NB001, we have found in our database that, being scored 0.42592594, the most similar ligand is CHEMBL3134492. Check out the elaboration below.
| NB001 (Given Ligand) | CHEMBL3134492 (Similar Ligand) |
|---|---|
| Nc1ncnc2c1ncn2CCNCCCCCO | C1CCC(C1)Nc2ncnc3[nH]ccc23 |
|
|
|
|
|
|
| 0000000a 01801c00 00180000 48080620 00180040 0000c000 00008000 20000800 00600100 00000080 0020900c 40011000 00001002 01800000 00080880 100c000c 00000000 00000000 00400000 80200201 80000000 30000040 21800041 02100014 08000000 00000000 00000000 10000000 08000008 00460010 c0080000 00000ac0 | 00014002 01800800 00180000 08080600 20080000 00006000 00008000 00100800 00000100 00000080 00200004 40011000 04000800 00000000 00020000 100c0004 00040000 00004008 08600000 00200005 40100000 18048060 20804040 00100014 00000000 80000000 00008000 10000080 00000008 01460000 c0001200 000006c0 |