On Target NK1R_HUMAN 0.41379312/CHEMBL2313631
For the given ligand NB001, we have found in our database that, being scored 0.41379312, the most similar ligand is CHEMBL2313631. Check out the elaboration below.
| NB001 (Given Ligand) | CHEMBL2313631 (Similar Ligand) |
|---|---|
| Nc1ncnc2c1ncn2CCNCCCCCO | CCOC(=O)N(C1CCN(CCN2C(=O)N(C3CC3)c4ccccc24)CC1)c5ccccc5 |
|
|
|
|
|
|
| 0000000a 01801c00 00180000 48080620 00180040 0000c000 00008000 20000800 00600100 00000080 0020900c 40011000 00001002 01800000 00080880 100c000c 00000000 00000000 00400000 80200201 80000000 30000040 21800041 02100014 08000000 00000000 00000000 10000000 08000008 00460010 c0080000 00000ac0 | 00004002 01401400 00100000 40010700 201c0040 0000c000 00000000 20000000 04200305 800009e0 0d28900c 50018000 00009002 01d00000 003208c0 001e100c 00868000 00880000 08600800 00400201 e0100000 38080cb0 21802003 02300018 1c000000 40000002 00000000 10200080 08008200 80460011 c0080000 00000a80 |