On Target OPRK_HUMAN 0.46258503/CHEMBL3394007
For the given ligand NB001, we have found in our database that, being scored 0.46258503, the most similar ligand is CHEMBL3394007. Check out the elaboration below.
| NB001 (Given Ligand) | CHEMBL3394007 (Similar Ligand) |
|---|---|
| Nc1ncnc2c1ncn2CCNCCCCCO | Clc1ccc(cc1)C(=O)Nc2nc3cccnc3n2CCN4CCCC4 |
|
|
|
|
|
|
| 0000000a 01801c00 00180000 48080620 00180040 0000c000 00008000 20000800 00600100 00000080 0020900c 40011000 00001002 01800000 00080880 100c000c 00000000 00000000 00400000 80200201 80000000 30000040 21800041 02100014 08000000 00000000 00000000 10000000 08000008 00460010 c0080000 00000ac0 | 00018006 01000c00 00184100 48010600 001c0040 0000c010 00008000 22001800 00600100 200808c8 0830900c 40019800 06009846 01a00000 002c08c0 000c0004 08000000 02004000 00600000 00a00201 c0000000 7c028730 21804801 02600014 08002000 80000080 02048000 90000000 09000108 00461811 c00c1080 00020f80 |