On Target ALDR_HUMAN 0.2689655/CHEMBL1405739
For the given ligand NB001, we have found in our database that, being scored 0.2689655, the most similar ligand is CHEMBL1405739. Check out the elaboration below.
| NB001 (Given Ligand) | CHEMBL1405739 (Similar Ligand) |
|---|---|
| Nc1ncnc2c1ncn2CCNCCCCCO | OC(=O)Cn1c2ccccc2c3nnc(S)nc13 |
|
|
|
|
|
|
| 0000000a 01801c00 00180000 48080620 00180040 0000c000 00008000 20000800 00600100 00000080 0020900c 40011000 00001002 01800000 00080880 100c000c 00000000 00000000 00400000 80200201 80000000 30000040 21800041 02100014 08000000 00000000 00000000 10000000 08000008 00460010 c0080000 00000ac0 | 00000002 00000808 e0001000 00100600 000c0040 0000c004 06000000 00601800 00000100 000008c0 0000000c 4001a000 00008806 00c00000 00040040 0c0cc00c 08008000 40800004 00600000 00260000 c0000000 1c008a78 23800846 84600006 00002c00 00000200 00000000 00000830 08000000 00460000 c0040200 002104c0 |