On Target ACM1_HUMAN 0.43382353/CHEMBL611476
For the given ligand NB001, we have found in our database that, being scored 0.43382353, the most similar ligand is CHEMBL611476. Check out the elaboration below.
| NB001 (Given Ligand) | CHEMBL611476 (Similar Ligand) |
|---|---|
| Nc1ncnc2c1ncn2CCNCCCCCO | CC1CCN(CC(=O)N2c3ccccc3C(=O)Nc4cccnc24)CC1 |
|
|
|
|
|
|
| 0000000a 01801c00 00180000 48080620 00180040 0000c000 00008000 20000800 00600100 00000080 0020900c 40011000 00001002 01800000 00080880 100c000c 00000000 00000000 00400000 80200201 80000000 30000040 21800041 02100014 08000000 00000000 00000000 10000000 08000008 00460010 c0080000 00000ac0 | 02000022 01800400 00104180 40000700 001c0040 00004060 00008000 20000000 06200100 c00008e0 0d20100c 5001a000 02009802 01e00000 803408c0 000c0004 08030000 0000c000 00600000 00000201 c0000000 38008678 21800041 82100010 08000000 c0000000 00008000 10040000 08000000 00460013 400c4000 00000e80 |