On Target CNR1_HUMAN 0.40229884/CHEMBL562668
For the given ligand NB001, we have found in our database that, being scored 0.40229884, the most similar ligand is CHEMBL562668. Check out the elaboration below.
| NB001 (Given Ligand) | CHEMBL562668 (Similar Ligand) |
|---|---|
| Nc1ncnc2c1ncn2CCNCCCCCO | CCNC1(CCN(CC1)c2ncnc3c2nc(c4ccccc4Cl)n3c5ccc(Cl)cc5)C(=O)N |
|
|
|
|
|
|
| 0000000a 01801c00 00180000 48080620 00180040 0000c000 00008000 20000800 00600100 00000080 0020900c 40011000 00001002 01800000 00080880 100c000c 00000000 00000000 00400000 80200201 80000000 30000040 21800041 02100014 08000000 00000000 00000000 10000000 08000008 00460010 c0080000 00000ac0 | 0003c00a 01801e00 00180100 18090e20 20080060 0000e010 00009000 28181800 10600100 100019e1 0020800c 5003b808 06009806 00100200 000e00c1 180c000c 08040008 02006200 00400000 80600201 e0100000 38048740 21806044 83510014 00002002 c1100240 00088400 10000080 0c02001c 00460c18 c0045800 008206c0 |