On Target AGTR2_HUMAN 0.33846155/CHEMBL376286
For the given ligand NB001, we have found in our database that, being scored 0.33846155, the most similar ligand is CHEMBL376286. Check out the elaboration below.
| NB001 (Given Ligand) | CHEMBL376286 (Similar Ligand) |
|---|---|
| Nc1ncnc2c1ncn2CCNCCCCCO | CC[C@@H](C)[C@H](NC(=O)c1cccc(Cn2ccnc2)c1)C(=O)O |
|
|
|
|
|
|
| 0000000a 01801c00 00180000 48080620 00180040 0000c000 00008000 20000800 00600100 00000080 0020900c 40011000 00001002 01800000 00080880 100c000c 00000000 00000000 00400000 80200201 80000000 30000040 21800041 02100014 08000000 00000000 00000000 10000000 08000008 00460010 c0080000 00000ac0 | 0001800a 01805a00 00100100 00010600 000810c1 00000000 10000000 22001000 00000100 00000cc0 00208008 4000b000 06009802 00000000 00000480 080c000c 10000000 02000000 00400800 00000201 80000000 18068e00 23000040 8140001c 00000000 c0000000 08000000 90000000 04000100 00460009 e00c4000 00000600 |