On Target OPRM_MOUSE 0.26923078/CHEMBL440765
For the given ligand NB001, we have found in our database that, being scored 0.26923078, the most similar ligand is CHEMBL440765. Check out the elaboration below.
| NB001 (Given Ligand) | CHEMBL440765 (Similar Ligand) |
|---|---|
| Nc1ncnc2c1ncn2CCNCCCCCO | CN([C@H]1CC[C@@]2(CCCO2)C[C@@H]1N3CCCC3)C(=O)Cc4ccccc4 |
|
|
|
|
|
|
| 0000000a 01801c00 00180000 48080620 00180040 0000c000 00008000 20000800 00600100 00000080 0020900c 40011000 00001002 01800000 00080880 100c000c 00000000 00000000 00400000 80200201 80000000 30000040 21800041 02100014 08000000 00000000 00000000 10000000 08000008 00460010 c0080000 00000ac0 | 00000040 01003000 00100100 04010700 00180000 00000010 00000000 20000008 00000080 000808c0 08200000 40019000 01008002 01882000 40080000 00081008 00a00000 02000000 02c02000 00000201 00000020 38240610 01000081 83500018 00000401 80000000 00000200 10000000 0c000200 00060003 00022000 00002e00 |