On Target SCN9A_HUMAN 0.32240438/CHEMBL252239
For the given ligand NB001, we have found in our database that, being scored 0.32240438, the most similar ligand is CHEMBL252239. Check out the elaboration below.
| NB001 (Given Ligand) | CHEMBL252239 (Similar Ligand) |
|---|---|
| Nc1ncnc2c1ncn2CCNCCCCCO | CC(C)(C)OC(=O)N[C@H](Cc1ccccc1)C(=O)NCc2nc3cccnc3n2C4(CC4)c5ccccc5 |
|
|
|
|
|
|
| 0000000a 01801c00 00180000 48080620 00180040 0000c000 00008000 20000800 00600100 00000080 0020900c 40011000 00001002 01800000 00080880 100c000c 00000000 00000000 00400000 80200201 80000000 30000040 21800041 02100014 08000000 00000000 00000000 10000000 08000008 00460010 c0080000 00000ac0 | 00000002 01c03a00 00184900 14010e00 000c0060 0011c000 00008000 2800300d 90d00b00 000818c0 0831800c 4001b800 0c009802 01902000 000e00c0 021e010c 08020008 02080002 80680818 00020a01 c0000101 38238e30 21800041 8340011c 00110800 c0000402 00008000 10200020 0c000204 0046080b e00c4000 00004680 |