On Target PGH2_HUMAN 0.26973686/CHEMBL2236578
For the given ligand NB001, we have found in our database that, being scored 0.26973686, the most similar ligand is CHEMBL2236578. Check out the elaboration below.
| NB001 (Given Ligand) | CHEMBL2236578 (Similar Ligand) |
|---|---|
| Nc1ncnc2c1ncn2CCNCCCCCO | [O-][N+](=O)c1c(NC2CCCCC2)nc3ccccn13 |
|
|
|
|
|
|
| 0000000a 01801c00 00180000 48080620 00180040 0000c000 00008000 20000800 00600100 00000080 0020900c 40011000 00001002 01800000 00080880 100c000c 00000000 00000000 00400000 80200201 80000000 30000040 21800041 02100014 08000000 00000000 00000000 10000000 08000008 00460010 c0080000 00000ac0 | 00014002 01000012 00384000 08000620 20040040 08006010 00009000 00100800 14000100 200000e0 01208004 40019000 04010900 00800000 00040041 000d0014 08001040 00004800 02202000 80a00001 40160200 1c008038 21804800 00300010 00000006 805000c0 60068400 10000080 00024008 00460800 40041000 08000280 |