On Target TRY1_HUMAN 0.3529412/CHEMBL39475
For the given ligand NB001, we have found in our database that, being scored 0.3529412, the most similar ligand is CHEMBL39475. Check out the elaboration below.
| NB001 (Given Ligand) | CHEMBL39475 (Similar Ligand) |
|---|---|
| Nc1ncnc2c1ncn2CCNCCCCCO | CC1=NC=C(NS(=O)(=O)Cc2ccccc2)C(=O)N1CC(=O)N[C@H]3CCCN(C3O)C(=N)N |
|
|
|
|
|
|
| 0000000a 01801c00 00180000 48080620 00180040 0000c000 00008000 20000800 00600100 00000080 0020900c 40011000 00001002 01800000 00080880 100c000c 00000000 00000000 00400000 80200201 80000000 30000040 21800041 02100014 08000000 00000000 00000000 10000000 08000008 00460010 c0080000 00000ac0 | 00000002 25007c24 00182104 54310e20 001800a4 0000e000 00001804 2040b008 06200701 000008e6 0020340c 5003a004 0000b422 81d42081 80120980 041c000c 10014018 42008500 00400000 80004211 80000000 38850e40 23800043 0270003e 0c000000 c0004000 60001000 1024000c 08044814 00460011 c0080000 40010ae0 |