On Target MIF_HUMAN 0.20338982/CHEMBL554271
For the given ligand NB001, we have found in our database that, being scored 0.20338982, the most similar ligand is CHEMBL554271. Check out the elaboration below.
| NB001 (Given Ligand) | CHEMBL554271 (Similar Ligand) |
|---|---|
| Nc1ncnc2c1ncn2CCNCCCCCO | Oc1ccc(cc1F)C2=NOC(CCN3C(=O)c4ccccc4C3=O)C2 |
|
|
|
|
|
|
| 0000000a 01801c00 00180000 48080620 00180040 0000c000 00008000 20000800 00600100 00000080 0020900c 40011000 00001002 01800000 00080880 100c000c 00000000 00000000 00400000 80200201 80000000 30000040 21800041 02100014 08000000 00000000 00000000 10000000 08000008 00460010 c0080000 00000ac0 | 00000000 01801808 20900102 12050e00 02000000 10048010 020000c0 22003000 00108948 000828c1 08310000 50018000 80008802 00201000 00000408 00090018 00002800 02000000 00d06000 00820601 80020100 38168690 010010c2 0050001c 00000001 c0220004 e0124000 92000001 0018c10a 00068003 e00c0000 00000600 |