On Target NMDE1_HUMAN 0.13125/CHEMBL2333945
For the given ligand NB001, we have found in our database that, being scored 0.13125, the most similar ligand is CHEMBL2333945. Check out the elaboration below.
| NB001 (Given Ligand) | CHEMBL2333945 (Similar Ligand) |
|---|---|
| Nc1ncnc2c1ncn2CCNCCCCCO | Fc1ccc(cc1Cl)S(=O)(=O)NCc2ccc(cc2)C(=O)NNC(=O)c3ccccc3 |
|
|
|
|
|
|
| 0000000a 01801c00 00180000 48080620 00180040 0000c000 00008000 20000800 00600100 00000080 0020900c 40011000 00001002 01800000 00080880 100c000c 00000000 00000000 00400000 80200201 80000000 30000040 21800041 02100014 08000000 00000000 00000000 10000000 08000008 00460010 c0080000 00000ac0 | 00008014 08808800 01180100 43b10600 00080000 00000010 04000801 00001000 00000100 40001848 40102000 60008800 82008804 00201201 a0200000 00000004 00002000 02100000 04400000 00006000 80000000 08028702 40000000 0840000c 02002000 80101004 40000000 0000000d 00000400 204e8002 80040000 001703e0 |