On Target TRPV3_HUMAN 0.43076923/CHEMBL3696397
For the given ligand Methylene Blue, we have found in our database that, being scored 0.43076923, the most similar ligand is CHEMBL3696397. Check out the elaboration below.
| Methylene Blue (Given Ligand) | CHEMBL3696397 (Similar Ligand) |
|---|---|
| CN(C)c3ccc2nc1ccc(=[N+](C)C)cc1sc2c3 | CC(C)[C@H](CO)NCc1nc(ccc1F)c2cc3ccccc3s2 |
|
|
|
|
|
|
| 0003000a 11800000 04000100 10000301 001c0060 00000000 00000080 18194008 00820200 10011843 00200a04 c0018200 00100810 01400000 0002a0c0 020c0004 10068800 02202098 0c614000 20410004 40000000 69088080 318001c0 88400000 02024002 84010008 41010000 000003c4 0018801c 00061c00 20040800 02c10400 | 0001249a 11000000 00104100 16010e00 008c01a1 00180022 004c0080 1a183049 00800200 10000841 00210204 40018280 00000812 00001000 00022480 020c010d 12028200 0200202a 04610000 20500201 40000000 59018088 33800080 20400010 02100002 c4000000 00000040 80001245 0010415c 00260404 20040800 20c14600 |