On Target ADRB2_HUMAN 0.35238096/CHEMBL193627
For the given ligand Methylene Blue, we have found in our database that, being scored 0.35238096, the most similar ligand is CHEMBL193627. Check out the elaboration below.
| Methylene Blue (Given Ligand) | CHEMBL193627 (Similar Ligand) |
|---|---|
| CN(C)c3ccc2nc1ccc(=[N+](C)C)cc1sc2c3 | CCN1C(=Cc2sc3ccccc3[n+]2C)C=Cc4cccc(C)c14 |
|
|
|
|
|
|
| 0003000a 11800000 04000100 10000301 001c0060 00000000 00000080 18194008 00820200 10011843 00200a04 c0018200 00100810 01400000 0002a0c0 020c0004 10068800 02202098 0c614000 20410004 40000000 69088080 318001c0 88400000 02024002 84010008 41010000 000003c4 0018801c 00061c00 20040800 02c10400 | 10030002 32020030 00004108 18010610 001c1020 00018006 200000a0 0e718c08 00404000 000418c1 00000a04 70018220 00000830 00602020 000220c0 023c060c 00020020 82802480 80200014 20100014 40000000 f8008898 20800106 82450000 02040406 cc004200 48000000 10000204 0800003c 00261001 05040000 00c10c00 |