On Target PPARG_HUMAN 0.31034482/CHEMBL4087052
For the given ligand Methylene Blue, we have found in our database that, being scored 0.31034482, the most similar ligand is CHEMBL4087052. Check out the elaboration below.
| Methylene Blue (Given Ligand) | CHEMBL4087052 (Similar Ligand) |
|---|---|
| CN(C)c3ccc2nc1ccc(=[N+](C)C)cc1sc2c3 | Cc1nc2cc(ccc2s1)S(=O)(=O)n3c(CCCC(=O)O)cc4cc(Cl)ccc34 |
|
|
|
|
|
|
| 0003000a 11800000 04000100 10000301 001c0060 00000000 00000080 18194008 00820200 10011843 00200a04 c0018200 00100810 01400000 0002a0c0 020c0004 10068800 02202098 0c614000 20410004 40000000 69088080 318001c0 88400000 02024002 84010008 41010000 000003c4 0018801c 00061c00 20040800 02c10400 | 0003805a 11804000 2100210a 10b10240 000c0020 00008000 45012080 00118408 00400840 200818c0 0810aa04 70809800 0600983e 00e40001 842220c1 020c040c 00000010 0600e184 00600018 00822001 c0000100 48018b88 21800050 9a410018 03806002 8c010000 60010000 0008008c 00014004 20821822 00041200 20c30c20 |