On Target ALDR_HUMAN 0.30522087/CHEMBL370478
For the given ligand Methylene Blue, we have found in our database that, being scored 0.30522087, the most similar ligand is CHEMBL370478. Check out the elaboration below.
| Methylene Blue (Given Ligand) | CHEMBL370478 (Similar Ligand) |
|---|---|
| CN(C)c3ccc2nc1ccc(=[N+](C)C)cc1sc2c3 | OC(=O)Cn1cc(Cc2nc3c(F)c(F)cc(F)c3s2)c4cc(ccc14)N5CCOCC5 |
|
|
|
|
|
|
| 0003000a 11800000 04000100 10000301 001c0060 00000000 00000080 18194008 00820200 10011843 00200a04 c0018200 00100810 01400000 0002a0c0 020c0004 10068800 02202098 0c614000 20410004 40000000 69088080 318001c0 88400000 02024002 84010008 41010000 000003c4 0018801c 00061c00 20040800 02c10400 | 0003440a 10800800 0010110a d6010618 000c50a0 00088010 00002080 0001f00b 00400044 004918c0 08248a04 d081a000 00008872 04409008 000230c8 060c458c 10041800 c28000cb 0830041c 40800004 40500800 58098ab8 32800022 86510016 03042402 8c000000 48100080 11400097 00008704 c0079002 20048200 20410620 |