On Target GRM5_HUMAN 0.3432836/CHEMBL1951664
For the given ligand Methylene Blue, we have found in our database that, being scored 0.3432836, the most similar ligand is CHEMBL1951664. Check out the elaboration below.
| Methylene Blue (Given Ligand) | CHEMBL1951664 (Similar Ligand) |
|---|---|
| CN(C)c3ccc2nc1ccc(=[N+](C)C)cc1sc2c3 | CCc1ccc(cc1)N2C=Cc3c(sc4nccc(N(C)C)c34)C2=O |
|
|
|
|
|
|
| 0003000a 11800000 04000100 10000301 001c0060 00000000 00000080 18194008 00820200 10011843 00200a04 c0018200 00100810 01400000 0002a0c0 020c0004 10068800 02202098 0c614000 20410004 40000000 69088080 318001c0 88400000 02024002 84010008 41010000 000003c4 0018801c 00061c00 20040800 02c10400 | 0003000a 31000a00 00004118 40014600 001c0000 00009860 00088002 10009008 06500000 400818e0 0c204a04 d0038080 80108830 00e00000 001020c0 00040c0c 10040000 22000090 08200010 00410000 40000080 588c8098 20800080 83700010 00004000 cc000008 40018080 00000084 04008000 0006000a 00058000 00c10e40 |