On Target P2RX3_HUMAN 0.359447/CHEMBL3901252
For the given ligand Methylene Blue, we have found in our database that, being scored 0.359447, the most similar ligand is CHEMBL3901252. Check out the elaboration below.
| Methylene Blue (Given Ligand) | CHEMBL3901252 (Similar Ligand) |
|---|---|
| CN(C)c3ccc2nc1ccc(=[N+](C)C)cc1sc2c3 | Cc1nc2ccc(NC3=NC=C(Br)C(=O)N3Cc4ccc(Cl)cc4)cc2s1 |
|
|
|
|
|
|
| 0003000a 11800000 04000100 10000301 001c0060 00000000 00000080 18194008 00820200 10011843 00200a04 c0018200 00100810 01400000 0002a0c0 020c0004 10068800 02202098 0c614000 20410004 40000000 69088080 318001c0 88400000 02024002 84010008 41010000 000003c4 0018801c 00061c00 20040800 02c10400 | 00038006 10808200 00000108 10010600 000c0020 0080c002 0800b280 00019008 06500100 000018e0 08201a0c d0058800 02109874 01c00000 000220c0 020c044c 00140040 9200c098 08600010 10a00004 c0000000 5c088180 21800841 83710000 02006002 8c000000 64048000 00050084 0500c20c 00461808 400c8008 88430480 |