On Target DRD3_HUMAN 0.33333334/CHEMBL2037521
For the given ligand Methylene Blue, we have found in our database that, being scored 0.33333334, the most similar ligand is CHEMBL2037521. Check out the elaboration below.
| Methylene Blue (Given Ligand) | CHEMBL2037521 (Similar Ligand) |
|---|---|
| CN(C)c3ccc2nc1ccc(=[N+](C)C)cc1sc2c3 | C(CCc1nc2ccccc2s1)CN3CCN(CC3)c4ncccn4 |
|
|
|
|
|
|
| 0003000a 11800000 04000100 10000301 001c0060 00000000 00000080 18194008 00820200 10011843 00200a04 c0018200 00100810 01400000 0002a0c0 020c0004 10068800 02202098 0c614000 20410004 40000000 69088080 318001c0 88400000 02024002 84010008 41010000 000003c4 0018801c 00061c00 20040800 02c10400 | 0003000a 11000000 00100008 14000600 000c0020 0000c000 030020c0 20018008 00400100 204018c0 00208a04 d0818000 00000072 00402000 000220c0 021c040c 00000000 04004080 00600018 00a00201 40200800 7e080080 20800861 02110010 02000002 0c000000 40000000 10000184 0800001c 00c61800 48001000 20410690 |