On Target P2Y12_HUMAN 0.3027523/CHEMBL585852
For the given ligand Methylene Blue, we have found in our database that, being scored 0.3027523, the most similar ligand is CHEMBL585852. Check out the elaboration below.
| Methylene Blue (Given Ligand) | CHEMBL585852 (Similar Ligand) |
|---|---|
| CN(C)c3ccc2nc1ccc(=[N+](C)C)cc1sc2c3 | CCc1cc2c(ncnc2s1)N3CCN(CC3)C(=O)c4ccc(cc4)c5ccccc5 |
|
|
|
|
|
|
| 0003000a 11800000 04000100 10000301 001c0060 00000000 00000080 18194008 00820200 10011843 00200a04 c0018200 00100810 01400000 0002a0c0 020c0004 10068800 02202098 0c614000 20410004 40000000 69088080 318001c0 88400000 02024002 84010008 41010000 000003c4 0018801c 00061c00 20040800 02c10400 | 00016002 11006800 00100138 4c090604 00100000 00005000 00088080 12009808 00000100 00491a40 00200204 e00a9080 84108812 0000a000 00402400 001c0404 00160000 0200401c 0c600010 10200004 c0100800 6a0e86a0 308040e0 1240001e 02000008 cc000000 40000000 800000c4 08404918 00460083 c0041000 00c106c0 |