On Target TRY1_HUMAN 0.31330472/CHEMBL341148
For the given ligand Methylene Blue, we have found in our database that, being scored 0.31330472, the most similar ligand is CHEMBL341148. Check out the elaboration below.
| Methylene Blue (Given Ligand) | CHEMBL341148 (Similar Ligand) |
|---|---|
| CN(C)c3ccc2nc1ccc(=[N+](C)C)cc1sc2c3 | NC(=N)NCCC[C@H](NC(=O)[C@@H]1CCCN1Cc2ccccc2)C(=O)c3nc4ccccc4s3.OC(=O)C(F)(F)F |
|
|
|
|
|
|
| 0003000a 11800000 04000100 10000301 001c0060 00000000 00000080 18194008 00820200 10011843 00200a04 c0018200 00100810 01400000 0002a0c0 020c0004 10068800 02202098 0c614000 20410004 40000000 69088080 318001c0 88400000 02024002 84010008 41010000 000003c4 0018801c 00061c00 20040800 02c10400 | 040380ca 11001000 00100128 14010e00 000c0020 00008010 030000a0 2201b008 00600200 00411ac2 00288a04 d083b000 0600b872 00502001 830224c0 121c440c 01000000 0e001080 00206018 00000205 40100800 780d8eb0 20802001 12510018 02003002 cc000000 40000000 90000184 08000114 00861001 b80c4000 20412610 |