On Target CXCR4_HUMAN 0.2599119/CHEMBL1644085
For the given ligand Methylene Blue, we have found in our database that, being scored 0.2599119, the most similar ligand is CHEMBL1644085. Check out the elaboration below.
| Methylene Blue (Given Ligand) | CHEMBL1644085 (Similar Ligand) |
|---|---|
| CN(C)c3ccc2nc1ccc(=[N+](C)C)cc1sc2c3 | NCc1sccc1CN(Cc2nc3ccccc3[nH]2)C4CCCc5cccnc45 |
|
|
|
|
|
|
| 0003000a 11800000 04000100 10000301 001c0060 00000000 00000080 18194008 00820200 10011843 00200a04 c0018200 00100810 01400000 0002a0c0 020c0004 10068800 02202098 0c614000 20410004 40000000 69088080 318001c0 88400000 02024002 84010008 41010000 000003c4 0018801c 00061c00 20040800 02c10400 | 0001001a 01004000 02104906 10800e10 00141162 00104000 01002080 22003003 00500900 000808c0 09318204 40818080 0000089a 00600821 00023440 020c0104 00002201 0600000e 00202408 00008209 40121100 580190a0 21804100 00500010 02148000 c4000001 08014040 90000084 00400106 00c60802 60040000 20c14681 |