On Target CNR2_HUMAN 0.33809525/CHEMBL2057795
For the given ligand Methylene Blue, we have found in our database that, being scored 0.33809525, the most similar ligand is CHEMBL2057795. Check out the elaboration below.
| Methylene Blue (Given Ligand) | CHEMBL2057795 (Similar Ligand) |
|---|---|
| CN(C)c3ccc2nc1ccc(=[N+](C)C)cc1sc2c3 | CCN1CCN(CC1)c2nc(C)nc3sc(cc23)c4ccccc4 |
|
|
|
|
|
|
| 0003000a 11800000 04000100 10000301 001c0060 00000000 00000080 18194008 00820200 10011843 00200a04 c0018200 00100810 01400000 0002a0c0 020c0004 10068800 02202098 0c614000 20410004 40000000 69088080 318001c0 88400000 02024002 84010008 41010000 000003c4 0018801c 00061c00 20040800 02c10400 | 00016042 11002800 00100138 1c090600 01100060 00005000 004c9080 18108808 10000100 00001a41 00202204 e00a9280 04100012 0001a000 00022000 021c0404 00160000 0200401c 0c600010 00200002 c0100000 6a0e20a0 30a040e0 1240001a 02001009 8c000000 40200000 000002c4 0840481c 00460080 40001000 00c102c0 |