On Target OPRX_HUMAN 0.2832618/CHEMBL3394749
For the given ligand Methylene Blue, we have found in our database that, being scored 0.2832618, the most similar ligand is CHEMBL3394749. Check out the elaboration below.
| Methylene Blue (Given Ligand) | CHEMBL3394749 (Similar Ligand) |
|---|---|
| CN(C)c3ccc2nc1ccc(=[N+](C)C)cc1sc2c3 | Cc1ccccc1CNC[C@H](O)CN2CN(c3ccccc3)C4(CCN(CCc5ccccc5c6cccs6)CC4)C2=O |
|
|
|
|
|
|
| 0003000a 11800000 04000100 10000301 001c0060 00000000 00000080 18194008 00820200 10011843 00200a04 c0018200 00100810 01400000 0002a0c0 020c0004 10068800 02202098 0c614000 20410004 40000000 69088080 318001c0 88400000 02024002 84010008 41010000 000003c4 0018801c 00061c00 20040800 02c10400 | 0003601e 01005401 00100120 14010e00 200000a0 00000000 00040084 2a103009 00200080 00080be1 08200204 5003b280 04009812 00202000 221a2440 00080008 30060200 0a402008 0c000040 00000a01 60120100 78298680 32024001 8351001a 02910000 c6000080 00004000 900082c4 0c00c108 00060413 201c5000 00c16600 |