On Target IKKB_HUMAN 0.45833334/CHEMBL2375678
For the given ligand Methylene Blue, we have found in our database that, being scored 0.45833334, the most similar ligand is CHEMBL2375678. Check out the elaboration below.
| Methylene Blue (Given Ligand) | CHEMBL2375678 (Similar Ligand) |
|---|---|
| CN(C)c3ccc2nc1ccc(=[N+](C)C)cc1sc2c3 | CNc1nc2cc(sc2c3c1ncn3C)c4nccs4 |
|
|
|
|
|
|
| 0003000a 11800000 04000100 10000301 001c0060 00000000 00000080 18194008 00820200 10011843 00200a04 c0018200 00100810 01400000 0002a0c0 020c0004 10068800 02202098 0c614000 20410004 40000000 69088080 318001c0 88400000 02024002 84010008 41010000 000003c4 0018801c 00061c00 20040800 02c10400 | 0003001a 31800810 00484110 10090620 801c0044 0000d000 1008a0a0 1919c008 00c00300 100000c1 01308a0c 50038280 80001810 00400000 080e20c0 000c080c 3a140000 02006098 08630010 a0f10000 c0000000 5d0480f8 218008c5 80610000 02004002 8c000008 00019cc0 00000284 0012883c 00463800 60040800 06c10ce0 |