On Target PERM_HUMAN 0.3253012/CHEMBL581893
For the given ligand Omeprazole, we have found in our database that, being scored 0.3253012, the most similar ligand is CHEMBL581893. Check out the elaboration below.
| Omeprazole (Given Ligand) | CHEMBL581893 (Similar Ligand) |
|---|---|
| COc3ccc2nc(S(=O)Cc1ncc(C)c(OC)c1C)[nH]c2c3 | COc1ccc2c(C)nc(NC(=N)N)nc2c1 |
|
|
|
|
|
|
| 00000002 44008028 2000652a 10502211 00041060 00004000 16080104 00000008 04020100 0001485d 01008004 42008000 00001806 40640000 81020041 022e200c 24000008 0200030c 80280820 00064000 42100002 1800aa20 21800000 01480000 00242000 90018000 48000048 00000000 00400304 00c60020 40080000 002580e0 | 00000002 00000808 20000108 00050e00 01041004 00004000 06002004 00002008 00000100 00000842 01200025 40108800 00000002 00500000 01020041 000c000c 00000000 02004008 00600000 00a60200 40000000 0c002028 20800840 00600100 00010010 80010000 40000000 00000000 0000021c 00460800 40000000 002800a0 |