On Target PAR1_HUMAN 0.2974359/CHEMBL207791
For the given ligand Omeprazole, we have found in our database that, being scored 0.2974359, the most similar ligand is CHEMBL207791. Check out the elaboration below.
| Omeprazole (Given Ligand) | CHEMBL207791 (Similar Ligand) |
|---|---|
| COc3ccc2nc(S(=O)Cc1ncc(C)c(OC)c1C)[nH]c2c3 | COc1ccc2nc(\C=C\[C@H]3[C@@H]4CCCC[C@H]4C[C@@H]5[C@H]3[C@@H](C)OC5=O)ccc2c1OC |
|
|
|
|
|
|
| 00000002 44008028 2000652a 10502211 00041060 00004000 16080104 00000008 04020100 0001485d 01008004 42008000 00001806 40640000 81020041 022e200c 24000008 0200030c 80280820 00064000 42100002 1800aa20 21800000 01480000 00242000 90018000 48000048 00000000 00400304 00c60020 40080000 002580e0 | 00050042 81000008 20004308 90010700 000c1020 00000000 86080080 08000408 00000000 00108848 00000004 40009000 0402c80e 00c00000 010a0443 020c900c 00820400 0a000004 02602000 00062201 40000020 08008a08 21808020 80410010 01002400 82000000 00406040 c0008200 00400204 0006000a 24060000 00240000 |