On Target TNFA_HUMAN 0.3115578/CHEMBL3972551
For the given ligand Omeprazole, we have found in our database that, being scored 0.3115578, the most similar ligand is CHEMBL3972551. Check out the elaboration below.
| Omeprazole (Given Ligand) | CHEMBL3972551 (Similar Ligand) |
|---|---|
| COc3ccc2nc(S(=O)Cc1ncc(C)c(OC)c1C)[nH]c2c3 | CCCCN1C(=O)N(C(=O)c2cnc3c(OC)cccc3c12)c4cccc(C)c4 |
|
|
|
|
|
|
| 00000002 44008028 2000652a 10502211 00041060 00004000 16080104 00000008 04020100 0001485d 01008004 42008000 00001806 40640000 81020041 022e200c 24000008 0200030c 80280820 00064000 42100002 1800aa20 21800000 01480000 00242000 90018000 48000048 00000000 00400304 00c60020 40080000 002580e0 | 00000002 00800208 60004108 02010700 000c1040 02004064 06088002 00201000 06100100 c00008e0 0d00000c 40058000 00009806 08e00000 113400c1 000c200c 08800008 0200c000 00600000 00020001 c0020080 18008078 21800041 81708010 00042400 c0000000 28008000 00040004 04404200 00460008 400c0000 00000680 |