On Target ACE_HUMAN 0.34/CHEMBL3414814
For the given ligand Omeprazole, we have found in our database that, being scored 0.34, the most similar ligand is CHEMBL3414814. Check out the elaboration below.
| Omeprazole (Given Ligand) | CHEMBL3414814 (Similar Ligand) |
|---|---|
| COc3ccc2nc(S(=O)Cc1ncc(C)c(OC)c1C)[nH]c2c3 | Cc1ccc(cc1)C2=Nc3ccccc3C(=O)N2CC(O)COc4cccc5[nH]c6ccccc6c45 |
|
|
|
|
|
|
| 00000002 44008028 2000652a 10502211 00041060 00004000 16080104 00000008 04020100 0001485d 01008004 42008000 00001806 40640000 81020041 022e200c 24000008 0200030c 80280820 00064000 42100002 1800aa20 21800000 01480000 00242000 90018000 48000048 00000000 00400304 00c60020 40080000 002580e0 | 04004002 00000008 a0100108 10010600 200c1060 02006120 06081800 00080008 06000102 d08208e0 0100800c 40018000 00809806 00e00000 012200c1 020c600c 00200020 0200a004 00e00000 00460000 c0100000 18008038 27800041 8c700010 00002002 c0000000 20000200 10840030 00004204 00460400 400c0a00 402000c0 |