On Target 5HT1B_HUMAN 0.38505748/CHEMBL190298
For the given ligand Omeprazole, we have found in our database that, being scored 0.38505748, the most similar ligand is CHEMBL190298. Check out the elaboration below.
| Omeprazole (Given Ligand) | CHEMBL190298 (Similar Ligand) |
|---|---|
| COc3ccc2nc(S(=O)Cc1ncc(C)c(OC)c1C)[nH]c2c3 | Cc1ccc2c(OCCN3CCN(Cc4cccc5[nH]cnc45)CC3)cccc2n1 |
|
|
|
|
|
|
| 00000002 44008028 2000652a 10502211 00041060 00004000 16080104 00000008 04020100 0001485d 01008004 42008000 00001806 40640000 81020041 022e200c 24000008 0200030c 80280820 00064000 42100002 1800aa20 21800000 01480000 00242000 90018000 48000048 00000000 00400304 00c60020 40080000 002580e0 | 14002002 00000808 20004108 14050612 000410e0 00004000 06004000 02001008 00000100 00010840 41208004 40008000 00800802 00402000 01121441 020c000c 10020008 02000004 00200000 40060200 40000000 28048828 33800020 82400000 00044000 c0000000 00000040 80000001 08000304 00460000 40048000 802402a0 |