On Target PERM_HUMAN 0.37037036/CHEMBL2347029
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.37037036, the most similar ligand is CHEMBL2347029. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL2347029 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | CCNC(=O)CCCc1c[nH]c2ccc(F)cc12 |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 00010002 01000800 00100102 42810610 00041100 00000030 00002000 20000000 00500800 000808c0 08300004 40019000 0c008802 00601800 00000040 00040005 00000000 02000080 00200400 00100201 40000100 18008608 20800000 80500018 00042000 80000000 08000000 10000001 00000000 00078003 00040200 00400620 |