On Target PDE5A_HUMAN 0.38666666/CHEMBL25616
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.38666666, the most similar ligand is CHEMBL25616. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL25616 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | [Na+].[O-]C(=O)C1CCN(CC1)c2nc(NCc3ccc4OCOc4c3)c5cc(Cl)ccc5n2 |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 0003c002 45000009 20100108 08090600 02141008 00004000 0204a000 22101880 00200100 200008c0 41200004 5001d800 0600c80e 20400000 01000041 002c800c 00040000 02004000 08680000 00a20201 40140200 1c048b28 21814840 00748010 40002000 80000080 002a0000 b00000c0 01008308 00460800 40041000 02830ac0 |