On Target COMT_HUMAN 0.32034633/CHEMBL3425740
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.32034633, the most similar ligand is CHEMBL3425740. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL3425740 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | CCCC(O)C1=CC(=O)C(=CN1c2cccc(c2)c3ccccc3)O |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 0000200a 01000a08 60005102 10010610 00041428 04004004 15800000 00201100 02100b00 800808c0 08108004 40818000 00008805 00600200 00020040 020c000c 00028000 06804004 04600008 00060001 40000100 18008030 31800002 81500414 02042400 c0080040 08520260 000500c0 04404004 0a86000a c0040000 60200400 |