On Target PAR1_HUMAN 0.41884816/CHEMBL3658403
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.41884816, the most similar ligand is CHEMBL3658403. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL3658403 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | CCc1ccc(cc1)C2CC(CN(C2)C(=O)C3(CC)COC3)C(=O)Nc4ccccc4 |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 00014002 01001400 00100102 00010700 20000000 00202000 00000000 20000004 00100980 000809e0 08380004 50019800 1c008012 00300000 00020040 00080008 10240000 02000001 08c00010 00000201 60100100 182c0620 21002080 81500018 00001001 80000000 00000000 10000080 04008200 00060013 00000000 00402600 |