On Target SC6A4_HUMAN 0.49197862/CHEMBL1224318
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.49197862, the most similar ligand is CHEMBL1224318. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL1224318 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | CC(C)(C)CCC1(CCNC1)C(=O)c2cnc(N)c(Cl)c2 |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 00038002 05804a00 00104182 c0800610 00041300 00000010 00002000 20400000 00500800 000800c0 00300004 40013800 0e00880a 00200800 80000100 00040004 00000000 02000004 00202418 00200201 c0000100 1c048310 20800800 0074001c 00041800 00000600 08000080 10000000 0040000a 0006080a 80020000 00820600 |