On Target MK01_HUMAN 0.44298247/CHEMBL3921309
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.44298247, the most similar ligand is CHEMBL3921309. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL3921309 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | C[C@@H](NC(=O)c1ccc(cc1F)c2cc(cnc2N)[C@H]3CCC(=O)N(C)C3)c4cccc(Cl)c4 |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 0001a082 0d805800 00104182 43810610 00041100 04000018 14002000 02081004 06500980 000928c8 08300004 5001b800 86008856 00201800 80020400 800c000c 02022200 02003004 04200400 10200203 c0000100 1c268700 31800800 b170001c 00042001 c0080080 08000280 90000041 04404108 00068003 80040800 00422600 |