On Target HYES_HUMAN 0.51794875/CHEMBL1078337
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.51794875, the most similar ligand is CHEMBL1078337. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL1078337 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | OC(=O)CCC1(CCCN(C1)C(=O)Nc2ccc(Cl)cc2)c3cccnc3 |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 00018006 01005000 00104102 01800e10 000c1100 00000000 00002004 20002005 00500880 000908c0 00380004 50019800 0600981e 01b00800 00000040 000c000c 00040008 02400004 08602400 00000201 40000100 18258f10 21822000 91500018 00152000 00000000 08080000 10000080 04408000 00060003 000a0000 02426600 |