On Target TRPV3_HUMAN 0.3855932/CHEMBL3949939
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.3855932, the most similar ligand is CHEMBL3949939. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL3949939 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | Cc1cccc2CCCN(C(=O)CSc3ncc(cc3Cl)C(F)(F)F)c12 |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 0000c002 21201200 20124160 08112611 20051001 80002040 00000d00 20400000 00060800 020a4cd0 08780024 60008800 0600880b 02150000 80021040 000c000e 04048020 02000004 08200028 00020201 c0100100 1a248700 21902000 04480039 00040802 91080200 08004010 910010c0 00688000 0006005b 10100080 22230660 |