On Target PPARG_HUMAN 0.42857143/CHEMBL181159
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.42857143, the most similar ligand is CHEMBL181159. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL181159 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | CCCCCN(CCOc1ccc(CCC(=O)O)cc1)c2ccccn2 |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 04006002 01000028 20107108 00010602 20041080 00002000 02040000 20100000 00000800 200808c0 08340004 40019000 04809802 00000000 010a1001 000c000c 10040000 02004000 08600008 00a20201 40100100 1c048a00 33800840 00700010 00000800 80000000 08120080 10000081 00008208 00060802 00001000 00000600 |