On Target CASP1_HUMAN 0.47906977/CHEMBL114791
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.47906977, the most similar ligand is CHEMBL114791. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL114791 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | OC(=O)C[C@H](NC(=O)[C@@H]1Cc2cccc3CC[C@H](NC(=O)c4cccc5ccccc45)C(=O)N1c23)C=O |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 0005c002 01003a00 00100122 04010600 20001001 00002040 03000000 2210100c 00100880 08090ac0 08380024 4001b000 0e008802 00302001 80020540 000c000a 00248000 02000001 08c00018 00000201 40100100 38368e08 21002083 8350001f 00001801 c0000080 00000010 90801080 0c088102 0006000b a0045080 20402600 |