On Target CHLE_HUMAN 0.49295774/CHEMBL223443
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.49295774, the most similar ligand is CHEMBL223443. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL223443 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | Clc1ccc2c(NCCCCCCCNC(=O)Cc3c[nH]c4ccccc34)c5CCCCc5nc2c1 |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 0001c00a 01005800 40104102 51810610 200c1120 00002040 0900a000 20000001 10400880 000908d0 08308004 40819800 13008806 00600800 c0020040 02040006 00048200 0600000c 08202408 00000201 44100100 18248718 20804000 91500018 00046000 80000001 08008040 10001080 04488006 00860003 00062280 20422660 |