On Target PDE4B_HUMAN 0.43369177/CHEMBL1257421
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.43369177, the most similar ligand is CHEMBL1257421. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL1257421 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | CC1(C)CCc2c(C1)c3c(nc2N4CCOCC4)sc5c(NCCCN6CCCC6=O)ncnc35 |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 00034002 11805c20 4010711a c98d0610 201c1184 0000c052 8100a000 20108909 00400900 200891f0 09340a04 d0039080 8c00982a 01e10802 080230ea 000c0d0c 30048200 0200408c 18602418 80a10205 64100100 5c8c86e8 3280c8c0 82600018 01046401 8c200009 480000c0 10001084 00ca8a1a 084e0813 40049080 20c12ee0 |