On Target BACE1_HUMAN 0.48815167/CHEMBL1934295
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.48815167, the most similar ligand is CHEMBL1934295. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL1934295 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | Clc1ccc2c(CCC[C@]23CNC[C@H]3C(=O)N4CC[C@H](C[C@H]4C5CCCCC5)c6ccccc6)n1 |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 0003800a 03005600 00504102 11810610 00041320 00000012 05002000 20000001 00600880 000909e0 08308004 50839800 0f00882e 00200800 40020000 02040004 00000200 06000004 02202418 00000201 40100100 18348710 20804000 91500018 00045800 80000101 08040040 10004080 04400006 0086001b 00022000 20822602 |