On Target DRD2_HUMAN 0.53846157/CHEMBL2059310
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.53846157, the most similar ligand is CHEMBL2059310. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL2059310 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | O=C1CCc2cccnc2N1CCCN3CCC(CC3)N4C(=O)Nc5ccccc45 |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 00004002 01005600 00184100 00800610 200c1240 000040c0 02002000 20100000 04600900 a00809e0 0d38802c 50019000 04009802 01d40800 003200c0 000c0006 00148000 02004004 08600408 00a00201 e0100100 1c088630 21802801 00700018 00041800 41000000 08000090 10001080 00488018 0046081b 40081080 20002780 |