On Target HPGDS_HUMAN 0.38942307/CHEMBL3425953
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.38942307, the most similar ligand is CHEMBL3425953. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL3425953 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | O=C(CCc1cccnc1)Nc2cncc(c2)c3cccc4[nH]ccc34 |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 00006002 00804a00 40104100 00810630 24041200 0c002018 00002000 00000000 00400800 400808d0 00380004 60009000 85008800 00700800 00020041 80040004 00060000 0200000c 0c200408 00000007 40100100 18028608 30802000 80400018 00041803 80180000 08000640 100000c0 00404000 0046000b 00040200 000006a0 |