On Target NOS1_HUMAN 0.4097561/CHEMBL3407814
For the given ligand 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione, we have found in our database that, being scored 0.4097561, the most similar ligand is CHEMBL3407814. Check out the elaboration below.
| 1-(4-chlorophenyl)-3-(3-hydroxy-1-methyl-2-oxo-2,3-dihydro-1H-pyrrolo [2,3-b]pyridin-3-yl)-1H-pyrrole-2,5-dione (Given Ligand) | CHEMBL3407814 (Similar Ligand) |
|---|---|
| CN4C(=O)C(O)(C2CC(=O)N(c1ccc(Cl)cc1)C2=O)c3cccnc34 | Cl.C(CNCCc1ccnc(n1)n2ccnc2)Cc3cccnc3 |
|
|
|
|
|
|
| 0007c002 01005a00 00187102 01800610 20141380 00006010 03002000 20100000 00700900 200b08c0 003800a4 4003d800 17009816 00300800 40020140 000c000c 00048000 02004004 08e00408 00a00201 40120500 1c348760 23802880 9170001c 00043801 00000200 08080090 10001080 0440800a 0006080b c0003080 22c20f00 | 04000002 00004a00 00105100 40840610 450412c4 00004002 00002000 20000100 00400980 000c02c0 0032800c 40010800 10001803 00100800 01020000 000c0004 00208000 0a800004 00600400 00200241 c0000920 1c208000 298008c0 01400114 00143000 00000200 08000000 10000000 0440000c 0046000a 40000000 200266a0 |